C16H20N4O2 — CID 70413852
7-[1-(diethylamino)ethoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one (PubChem CID 70413852) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 7-[1-(diethylamino)ethoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one.
| Compound Name | 7-[1-(diethylamino)ethoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
|---|---|
| PubChem CID | 70413852 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 7-[1-(diethylamino)ethoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
| SMILES | CCN(CC)C(C)Oc1ccc2nc3[nH]c(=O)[nH]c3cc2c1 |
| InChI | InChI=1S/C16H20N4O2/c1-4-20(5-2)10(3)22-12-6-7-13-11(8-12)9-14-15(17-13)19-16(21)18-14/h6-10H,4-5H2,1-3H3,(H2,17,18,19,21) |
| InChIKey | SYZSAZMFZORVDY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|