C14H9NO2 — CID 15005905
2-phenyl-1,3-benzoxazole-4-carbaldehyde (PubChem CID 15005905) has the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-phenyl-1,3-benzoxazole-4-carbaldehyde.
| Compound Name | 2-phenyl-1,3-benzoxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 15005905 |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-phenyl-1,3-benzoxazole-4-carbaldehyde |
| SMILES | O=Cc1cccc2oc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C14H9NO2/c16-9-11-7-4-8-12-13(11)15-14(17-12)10-5-2-1-3-6-10/h1-9H |
| InChIKey | SYWDFIADYXEEIQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|