C20H30N2O4S — CID 150094576
butyl 2-(ethylcarbamoyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate (PubChem CID 150094576) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is butyl 2-(ethylcarbamoyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate.
| Compound Name | butyl 2-(ethylcarbamoyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 150094576 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | butyl 2-(ethylcarbamoyl)-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC(SCc2ccc(OC)cc2)CC1C(=O)NCC |
| InChI | InChI=1S/C20H30N2O4S/c1-4-6-11-26-20(24)22-13-17(12-18(22)19(23)21-5-2)27-14-15-7-9-16(25-3)10-8-15/h7-10,17-18H,4-6,11-14H2,1-3H3,(H,21,23) |
| InChIKey | DTYFAAJXFGUPIE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|