C26H32FNO4S — CID 69432017
butyl (2R,4R)-2-[3-(4-fluorophenyl)-3-oxopropyl]-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate (PubChem CID 69432017) has the molecular formula C26H32FNO4S and a molecular weight of 473.61 g/mol. Its IUPAC name is butyl (2R,4R)-2-[3-(4-fluorophenyl)-3-oxopropyl]-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate.
| Compound Name | butyl (2R,4R)-2-[3-(4-fluorophenyl)-3-oxopropyl]-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69432017 |
| Molecular Formula | C26H32FNO4S |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | butyl (2R,4R)-2-[3-(4-fluorophenyl)-3-oxopropyl]-4-[(4-methoxyphenyl)methylsulfanyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1C[C@H](SCc2ccc(OC)cc2)C[C@H]1CCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H32FNO4S/c1-3-4-15-32-26(30)28-17-24(33-18-19-5-12-23(31-2)13-6-19)16-22(28)11-14-25(29)20-7-9-21(27)10-8-20/h5-10,12-13,22,24H,3-4,11,14-18H2,1-2H3/t22-,24-/m1/s1 |
| InChIKey | BOXIJUQKTINBDX-ISKFKSNPSA-N |
| XLogP | 6.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|