C23H20IN3O5S — CID 150100000
2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-(iodomethyl)-2-[(4-nitrophenyl)methyl]but-3-enoic acid (PubChem CID 150100000) has the molecular formula C23H20IN3O5S and a molecular weight of 577.40 g/mol. Its IUPAC name is 2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-(iodomethyl)-2-[(4-nitrophenyl)methyl]but-3-enoic acid.
| Compound Name | 2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-(iodomethyl)-2-[(4-nitrophenyl)methyl]but-3-enoic acid |
|---|---|
| PubChem CID | 150100000 |
| Molecular Formula | C23H20IN3O5S |
| Molecular Weight | 577.40 g/mol |
| Exact Mass | 577.02 |
| IUPAC Name | 2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-(iodomethyl)-2-[(4-nitrophenyl)methyl]but-3-enoic acid |
| SMILES | C=C(CI)C(Cc1ccc([N+](=O)[O-])cc1)(C(=O)O)N1C(=O)C2N=C(Cc3ccccc3)SC21 |
| InChI | InChI=1S/C23H20IN3O5S/c1-14(13-24)23(22(29)30,12-16-7-9-17(10-8-16)27(31)32)26-20(28)19-21(26)33-18(25-19)11-15-5-3-2-4-6-15/h2-10,19,21H,1,11-13H2,(H,29,30) |
| InChIKey | DVAPARZYMNHDSZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|