C30H25Cl2N3O7S — CID 57248339
(2R,5R,6R)-2-[(1,2-dichloro-3-oxo-3-phenoxy-2-phenylpropylidene)amino]-3,3-dimethyl-6-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 57248339) has the molecular formula C30H25Cl2N3O7S and a molecular weight of 642.52 g/mol. Its IUPAC name is (2R,5R,6R)-2-[(1,2-dichloro-3-oxo-3-phenoxy-2-phenylpropylidene)amino]-3,3-dimethyl-6-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2R,5R,6R)-2-[(1,2-dichloro-3-oxo-3-phenoxy-2-phenylpropylidene)amino]-3,3-dimethyl-6-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 57248339 |
| Molecular Formula | C30H25Cl2N3O7S |
| Molecular Weight | 642.52 g/mol |
| Exact Mass | 641.08 |
| IUPAC Name | (2R,5R,6R)-2-[(1,2-dichloro-3-oxo-3-phenoxy-2-phenylpropylidene)amino]-3,3-dimethyl-6-[(4-nitrophenyl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](Cc3ccc([N+](=O)[O-])cc3)C(=O)N2[C@@]1(N=C(Cl)C(Cl)(C(=O)Oc1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H25Cl2N3O7S/c1-28(2)30(26(37)38,34-23(36)22(24(34)43-28)17-18-13-15-20(16-14-18)35(40)41)33-25(31)29(32,19-9-5-3-6-10-19)27(39)42-21-11-7-4-8-12-21/h3-16,22,24H,17H2,1-2H3,(H,37,38)/t22-,24-,29?,30+/m1/s1 |
| InChIKey | JUEQHYLZAPPKGJ-VYVADFEQSA-N |
| XLogP | 5.61 |
| TPSA | 139.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|