C36H32N3O8PS — CID 54335803
(4-nitrophenyl)methyl 3-bis(4-methylphenyl)phosphoryloxy-2-[7-oxo-3-(phenoxymethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-2-enoate (PubChem CID 54335803) has the molecular formula C36H32N3O8PS and a molecular weight of 697.71 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-bis(4-methylphenyl)phosphoryloxy-2-[7-oxo-3-(phenoxymethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 3-bis(4-methylphenyl)phosphoryloxy-2-[7-oxo-3-(phenoxymethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-2-enoate |
|---|---|
| PubChem CID | 54335803 |
| Molecular Formula | C36H32N3O8PS |
| Molecular Weight | 697.71 g/mol |
| Exact Mass | 697.16 |
| IUPAC Name | (4-nitrophenyl)methyl 3-bis(4-methylphenyl)phosphoryloxy-2-[7-oxo-3-(phenoxymethyl)-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-2-enoate |
| SMILES | CC(OP(=O)(c1ccc(C)cc1)c1ccc(C)cc1)=C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C2N=C(COc3ccccc3)SC21 |
| InChI | InChI=1S/C36H32N3O8PS/c1-23-9-17-29(18-10-23)48(44,30-19-11-24(2)12-20-30)47-25(3)33(36(41)46-21-26-13-15-27(16-14-26)39(42)43)38-34(40)32-35(38)49-31(37-32)22-45-28-7-5-4-6-8-28/h4-20,32,35H,21-22H2,1-3H3 |
| InChIKey | TVJMZGGHCYNSLF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 137.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|