C35H31N2O8PS — CID 70510948
(4-methoxyphenyl)methyl 2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-diphenoxyphosphoryloxybut-2-enoate (PubChem CID 70510948) has the molecular formula C35H31N2O8PS and a molecular weight of 670.68 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-diphenoxyphosphoryloxybut-2-enoate.
| Compound Name | (4-methoxyphenyl)methyl 2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-diphenoxyphosphoryloxybut-2-enoate |
|---|---|
| PubChem CID | 70510948 |
| Molecular Formula | C35H31N2O8PS |
| Molecular Weight | 670.68 g/mol |
| Exact Mass | 670.15 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-diphenoxyphosphoryloxybut-2-enoate |
| SMILES | COc1ccc(COC(=O)C(=C(C)OP(=O)(Oc2ccccc2)Oc2ccccc2)N2C(=O)C3N=C(Cc4ccccc4)SC32)cc1 |
| InChI | InChI=1S/C35H31N2O8PS/c1-24(43-46(40,44-28-14-8-4-9-15-28)45-29-16-10-5-11-17-29)32(35(39)42-23-26-18-20-27(41-2)21-19-26)37-33(38)31-34(37)47-30(36-31)22-25-12-6-3-7-13-25/h3-21,31,34H,22-23H2,1-2H3 |
| InChIKey | BWOUSXNMNDEGJH-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 112.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.68 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|