C21H26ClN2O6PS — CID 88722433
tert-butyl 2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-[chloro(ethoxy)phosphoryl]oxybut-2-enoate (PubChem CID 88722433) has the molecular formula C21H26ClN2O6PS and a molecular weight of 500.94 g/mol. Its IUPAC name is tert-butyl 2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-[chloro(ethoxy)phosphoryl]oxybut-2-enoate.
| Compound Name | tert-butyl 2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-[chloro(ethoxy)phosphoryl]oxybut-2-enoate |
|---|---|
| PubChem CID | 88722433 |
| Molecular Formula | C21H26ClN2O6PS |
| Molecular Weight | 500.94 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | tert-butyl 2-(3-benzyl-7-oxo-4-thia-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl)-3-[chloro(ethoxy)phosphoryl]oxybut-2-enoate |
| SMILES | CCOP(=O)(Cl)OC(C)=C(C(=O)OC(C)(C)C)N1C(=O)C2N=C(Cc3ccccc3)SC21 |
| InChI | InChI=1S/C21H26ClN2O6PS/c1-6-28-31(22,27)30-13(2)17(20(26)29-21(3,4)5)24-18(25)16-19(24)32-15(23-16)12-14-10-8-7-9-11-14/h7-11,16,19H,6,12H2,1-5H3 |
| InChIKey | HONGROYHTVCZBX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.94 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|