C31H26F3N3O2 — CID 150110904
2-[1-(cyclopropylmethyl)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carbaldehyde (PubChem CID 150110904) has the molecular formula C31H26F3N3O2 and a molecular weight of 529.56 g/mol. Its IUPAC name is 2-[1-(cyclopropylmethyl)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carbaldehyde.
| Compound Name | 2-[1-(cyclopropylmethyl)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 150110904 |
| Molecular Formula | C31H26F3N3O2 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 2-[1-(cyclopropylmethyl)-5-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carbaldehyde |
| SMILES | COc1cc(C=O)cc2nc(-c3cc4cc(/C=C/c5ccc(C(F)(F)F)cc5)ccc4n3CC3CC3)n(C)c12 |
| InChI | InChI=1S/C31H26F3N3O2/c1-36-29-25(14-22(18-38)15-28(29)39-2)35-30(36)27-16-23-13-20(9-12-26(23)37(27)17-21-5-6-21)4-3-19-7-10-24(11-8-19)31(32,33)34/h3-4,7-16,18,21H,5-6,17H2,1-2H3/b4-3+ |
| InChIKey | DXFQRMKZRMVYHM-ONEGZZNKSA-N |
| XLogP | 7.62 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|