C21H20N4O2 — CID 172766123
2-[1-(cyclopropylmethyl)-6-methoxypyrrolo[2,3-b]pyridin-2-yl]-1-methylbenzimidazole-5-carbaldehyde (PubChem CID 172766123) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-[1-(cyclopropylmethyl)-6-methoxypyrrolo[2,3-b]pyridin-2-yl]-1-methylbenzimidazole-5-carbaldehyde.
| Compound Name | 2-[1-(cyclopropylmethyl)-6-methoxypyrrolo[2,3-b]pyridin-2-yl]-1-methylbenzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 172766123 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[1-(cyclopropylmethyl)-6-methoxypyrrolo[2,3-b]pyridin-2-yl]-1-methylbenzimidazole-5-carbaldehyde |
| SMILES | COc1ccc2cc(-c3nc4cc(C=O)ccc4n3C)n(CC3CC3)c2n1 |
| InChI | InChI=1S/C21H20N4O2/c1-24-17-7-5-14(12-26)9-16(17)22-21(24)18-10-15-6-8-19(27-2)23-20(15)25(18)11-13-3-4-13/h5-10,12-13H,3-4,11H2,1-2H3 |
| InChIKey | MIJVDPNZMFXGKX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|