C27H23FN4O3 — CID 175115257
2-[1-(cyclopropylmethyl)-6-[(6-fluoro-3-pyridinyl)oxy]indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carbaldehyde (PubChem CID 175115257) has the molecular formula C27H23FN4O3 and a molecular weight of 470.50 g/mol. Its IUPAC name is 2-[1-(cyclopropylmethyl)-6-[(6-fluoro-3-pyridinyl)oxy]indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carbaldehyde.
| Compound Name | 2-[1-(cyclopropylmethyl)-6-[(6-fluoro-3-pyridinyl)oxy]indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 175115257 |
| Molecular Formula | C27H23FN4O3 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2-[1-(cyclopropylmethyl)-6-[(6-fluoro-3-pyridinyl)oxy]indol-2-yl]-7-methoxy-1-methylbenzimidazole-5-carbaldehyde |
| SMILES | COc1cc(C=O)cc2nc(-c3cc4ccc(Oc5ccc(F)nc5)cc4n3CC3CC3)n(C)c12 |
| InChI | InChI=1S/C27H23FN4O3/c1-31-26-21(9-17(15-33)10-24(26)34-2)30-27(31)23-11-18-5-6-19(35-20-7-8-25(28)29-13-20)12-22(18)32(23)14-16-3-4-16/h5-13,15-16H,3-4,14H2,1-2H3 |
| InChIKey | BJSNLRINIPBWHW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|