C26H32N4O2 — CID 15011102
(8R,9S,13S,14S,17S)-2,4-bis(imidazol-1-ylmethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 15011102) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-2,4-bis(imidazol-1-ylmethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-2,4-bis(imidazol-1-ylmethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 15011102 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (8R,9S,13S,14S,17S)-2,4-bis(imidazol-1-ylmethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@@H]3c4cc(Cn5ccnc5)c(O)c(Cn5ccnc5)c4CC[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C26H32N4O2/c1-26-7-6-19-20(23(26)4-5-24(26)31)3-2-18-21(19)12-17(13-29-10-8-27-15-29)25(32)22(18)14-30-11-9-28-16-30/h8-12,15-16,19-20,23-24,31-32H,2-7,13-14H2,1H3/t19-,20+,23-,24-,26-/m0/s1 |
| InChIKey | PXZIEZQMJICMJM-CQHNIDLLSA-N |
| XLogP | 4.10 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|