C20H25F3N6O2 — CID 150126258
3-[[N'-(2-methylpropyl)carbamimidoyl]amino]-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide (PubChem CID 150126258) has the molecular formula C20H25F3N6O2 and a molecular weight of 438.45 g/mol. Its IUPAC name is 3-[[N'-(2-methylpropyl)carbamimidoyl]amino]-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide.
| Compound Name | 3-[[N'-(2-methylpropyl)carbamimidoyl]amino]-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 150126258 |
| Molecular Formula | C20H25F3N6O2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 3-[[N'-(2-methylpropyl)carbamimidoyl]amino]-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
| SMILES | CC(C)C/N=C(\N)Nc1cnccc1C(=O)NC(C)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C20H25F3N6O2/c1-12(2)8-27-19(24)29-16-10-25-7-6-15(16)18(30)28-13(3)14-4-5-17(26-9-14)31-11-20(21,22)23/h4-7,9-10,12-13H,8,11H2,1-3H3,(H,28,30)(H3,24,27,29) |
| InChIKey | FAHBOGPCLMNYGG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|