C20H24F3N5O3 — CID 150827183
2-hydroxy-N-[1-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]-4-pyridinyl]ethyl]-4-(trifluoromethoxy)benzamide (PubChem CID 150827183) has the molecular formula C20H24F3N5O3 and a molecular weight of 439.44 g/mol. Its IUPAC name is 2-hydroxy-N-[1-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]-4-pyridinyl]ethyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | 2-hydroxy-N-[1-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]-4-pyridinyl]ethyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 150827183 |
| Molecular Formula | C20H24F3N5O3 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-hydroxy-N-[1-[2-[[N'-(2-methylpropyl)carbamimidoyl]amino]-4-pyridinyl]ethyl]-4-(trifluoromethoxy)benzamide |
| SMILES | CC(C)C/N=C(\N)Nc1cc(C(C)NC(=O)c2ccc(OC(F)(F)F)cc2O)ccn1 |
| InChI | InChI=1S/C20H24F3N5O3/c1-11(2)10-26-19(24)28-17-8-13(6-7-25-17)12(3)27-18(30)15-5-4-14(9-16(15)29)31-20(21,22)23/h4-9,11-12,29H,10H2,1-3H3,(H,27,30)(H3,24,25,26,28) |
| InChIKey | KLDZYXPDVXDXBL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|