C14H25NO2 — CID 150151996
4-butyl-1-(2,2-dimethylbutyl)-3-hydroxy-2H-pyrrol-5-one (PubChem CID 150151996) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 4-butyl-1-(2,2-dimethylbutyl)-3-hydroxy-2H-pyrrol-5-one.
| Compound Name | 4-butyl-1-(2,2-dimethylbutyl)-3-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 150151996 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 4-butyl-1-(2,2-dimethylbutyl)-3-hydroxy-2H-pyrrol-5-one |
| SMILES | CCCCC1=C(O)CN(CC(C)(C)CC)C1=O |
| InChI | InChI=1S/C14H25NO2/c1-5-7-8-11-12(16)9-15(13(11)17)10-14(3,4)6-2/h16H,5-10H2,1-4H3 |
| InChIKey | FFLAAIXPIZXXCG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |