C11H7ClF3N3O4 — CID 15017281
5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenol (PubChem CID 15017281) has the molecular formula C11H7ClF3N3O4 and a molecular weight of 337.64 g/mol. Its IUPAC name is 5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenol.
| Compound Name | 5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenol |
|---|---|
| PubChem CID | 15017281 |
| Molecular Formula | C11H7ClF3N3O4 |
| Molecular Weight | 337.64 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenol |
| SMILES | Cn1nc(Oc2ccc([N+](=O)[O-])c(O)c2)c(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C11H7ClF3N3O4/c1-17-9(11(13,14)15)8(12)10(16-17)22-5-2-3-6(18(20)21)7(19)4-5/h2-4,19H,1H3 |
| InChIKey | HIRLFGGFRLUXFI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|