C18H19ClF3N3O6 — CID 19786320
butyl 3-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]propanoate (PubChem CID 19786320) has the molecular formula C18H19ClF3N3O6 and a molecular weight of 465.81 g/mol. Its IUPAC name is butyl 3-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]propanoate.
| Compound Name | butyl 3-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 19786320 |
| Molecular Formula | C18H19ClF3N3O6 |
| Molecular Weight | 465.81 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | butyl 3-[5-[4-chloro-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]oxy-2-nitrophenoxy]propanoate |
| SMILES | CCCCOC(=O)CCOc1cc(Oc2nn(C)c(C(F)(F)F)c2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19ClF3N3O6/c1-3-4-8-30-14(26)7-9-29-13-10-11(5-6-12(13)25(27)28)31-17-15(19)16(18(20,21)22)24(2)23-17/h5-6,10H,3-4,7-9H2,1-2H3 |
| InChIKey | OBADCJPIKKBIIR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.81 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|