C33H28F3O4P — CID 15019346
ethyl 2-[(E)-4-methoxy-4-oxo-2-(trifluoromethyl)-3-(triphenyl-lambda5-phosphanylidene)but-1-enyl]benzoate (PubChem CID 15019346) has the molecular formula C33H28F3O4P and a molecular weight of 576.55 g/mol. Its IUPAC name is ethyl 2-[(E)-4-methoxy-4-oxo-2-(trifluoromethyl)-3-(triphenyl-lambda5-phosphanylidene)but-1-enyl]benzoate.
| Compound Name | ethyl 2-[(E)-4-methoxy-4-oxo-2-(trifluoromethyl)-3-(triphenyl-lambda5-phosphanylidene)but-1-enyl]benzoate |
|---|---|
| PubChem CID | 15019346 |
| Molecular Formula | C33H28F3O4P |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | ethyl 2-[(E)-4-methoxy-4-oxo-2-(trifluoromethyl)-3-(triphenyl-lambda5-phosphanylidene)but-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1/C=C(/C(C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C33H28F3O4P/c1-3-40-31(37)28-22-14-13-15-24(28)23-29(33(34,35)36)30(32(38)39-2)41(25-16-7-4-8-17-25,26-18-9-5-10-19-26)27-20-11-6-12-21-27/h4-23H,3H2,1-2H3/b29-23- |
| InChIKey | WKPVASVYBRYWSD-FAJYDZGRSA-N |
| XLogP | 6.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|