C10H9BiF12O2 — CID 150245970
2-butan-2-yl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2-dioxabismolane (PubChem CID 150245970) has the molecular formula C10H9BiF12O2 and a molecular weight of 598.14 g/mol. Its IUPAC name is 2-butan-2-yl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2-dioxabismolane.
| Compound Name | 2-butan-2-yl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2-dioxabismolane |
|---|---|
| PubChem CID | 150245970 |
| Molecular Formula | C10H9BiF12O2 |
| Molecular Weight | 598.14 g/mol |
| Exact Mass | 598.02 |
| IUPAC Name | 2-butan-2-yl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2-dioxabismolane |
| SMILES | CCC(C)[Bi]1OC(C(F)(F)F)(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C6F12O2.C4H9.Bi/c7-3(8,9)1(19,4(10,11)12)2(20,5(13,14)15)6(16,17)18;1-3-4-2;/h;3H,4H2,1-2H3;/q-2;;+2 |
| InChIKey | VYENHLWTGWUINV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.14 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |