C16H14BrNO5S — CID 150253505
(4-bromobenzoyl) 6-methylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate (PubChem CID 150253505) has the molecular formula C16H14BrNO5S and a molecular weight of 412.26 g/mol. Its IUPAC name is (4-bromobenzoyl) 6-methylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate.
| Compound Name | (4-bromobenzoyl) 6-methylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
|---|---|
| PubChem CID | 150253505 |
| Molecular Formula | C16H14BrNO5S |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | (4-bromobenzoyl) 6-methylsulfonyl-2,3-dihydro-1H-pyrrolizine-1-carboxylate |
| SMILES | CS(=O)(=O)c1cc2n(c1)CCC2C(=O)OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrNO5S/c1-24(21,22)12-8-14-13(6-7-18(14)9-12)16(20)23-15(19)10-2-4-11(17)5-3-10/h2-5,8-9,13H,6-7H2,1H3 |
| InChIKey | GABJGULFJMDZAD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|