C8H9F6NO2 — CID 150253742
3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]but-2-enoic acid (PubChem CID 150253742) has the molecular formula C8H9F6NO2 and a molecular weight of 265.15 g/mol. Its IUPAC name is 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]but-2-enoic acid.
| Compound Name | 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]but-2-enoic acid |
|---|---|
| PubChem CID | 150253742 |
| Molecular Formula | C8H9F6NO2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 3-[[3,3,3-trifluoro-2-(trifluoromethyl)propyl]amino]but-2-enoic acid |
| SMILES | CC(=CC(=O)O)NCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H9F6NO2/c1-4(2-6(16)17)15-3-5(7(9,10)11)8(12,13)14/h2,5,15H,3H2,1H3,(H,16,17) |
| InChIKey | GACSLMHLQHCTAO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|