C29H42O2 — CID 150279149
3-decoxy-2-(3-methylbutyl)-5-[(E)-2-phenylethenyl]phenol (PubChem CID 150279149) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is 3-decoxy-2-(3-methylbutyl)-5-[(E)-2-phenylethenyl]phenol.
| Compound Name | 3-decoxy-2-(3-methylbutyl)-5-[(E)-2-phenylethenyl]phenol |
|---|---|
| PubChem CID | 150279149 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 3-decoxy-2-(3-methylbutyl)-5-[(E)-2-phenylethenyl]phenol |
| SMILES | CCCCCCCCCCOc1cc(/C=C/c2ccccc2)cc(O)c1CCC(C)C |
| InChI | InChI=1S/C29H42O2/c1-4-5-6-7-8-9-10-14-21-31-29-23-26(19-18-25-15-12-11-13-16-25)22-28(30)27(29)20-17-24(2)3/h11-13,15-16,18-19,22-24,30H,4-10,14,17,20-21H2,1-3H3/b19-18+ |
| InChIKey | GFFBHPATLZYYDA-VHEBQXMUSA-N |
| XLogP | 8.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|