About 4-hexyl-4H-triazin-5-one
4-hexyl-4H-triazin-5-one (PubChem CID 150287758) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-hexyl-4H-triazin-5-one.
Molecular Properties
| Compound Name | 4-hexyl-4H-triazin-5-one |
| PubChem CID | 150287758 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 4-hexyl-4H-triazin-5-one |
| SMILES | CCCCCCC1N=NN=CC1=O |
| InChI | InChI=1S/C9H15N3O/c1-2-3-4-5-6-8-9(13)7-10-12-11-8/h7-8H,2-6H2,1H3 |
| InChIKey | GGXYYVDFSXTESG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexyl-4H-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexyl-4H-triazin-5-one?
The IUPAC name of 4-hexyl-4H-triazin-5-one (CID 150287758) is 4-hexyl-4H-triazin-5-one.
What is the SMILES notation for 4-hexyl-4H-triazin-5-one?
The canonical SMILES for 4-hexyl-4H-triazin-5-one is CCCCCCC1N=NN=CC1=O.
What is the InChIKey of 4-hexyl-4H-triazin-5-one?
The InChIKey is GGXYYVDFSXTESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-2-3-4-5-6-8-9(13)7-10-12-11-8/h7-8H,2-6H2,1H3.
What are the key properties of 4-hexyl-4H-triazin-5-one?
4-hexyl-4H-triazin-5-one has a molecular weight of 181.24 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexyl-4H-triazin-5-one is sourced from PubChem (CID 150287758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).