C15H28N2 — CID 150294617
1-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-1-heptan-4-ylhydrazine (PubChem CID 150294617) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 1-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-1-heptan-4-ylhydrazine.
| Compound Name | 1-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-1-heptan-4-ylhydrazine |
|---|---|
| PubChem CID | 150294617 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 1-(6,6-dimethylcyclohexa-2,4-dien-1-yl)-1-heptan-4-ylhydrazine |
| SMILES | CCCC(CCC)N(N)C1C=CC=CC1(C)C |
| InChI | InChI=1S/C15H28N2/c1-5-9-13(10-6-2)17(16)14-11-7-8-12-15(14,3)4/h7-8,11-14H,5-6,9-10,16H2,1-4H3 |
| InChIKey | GIIBUMIQHXWZGY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|