C13H24N2 — CID 123200969
1-[2,2-dimethyl-1-(5-methylcyclohexa-1,3-dien-1-yl)propyl]-1-methylhydrazine (PubChem CID 123200969) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-[2,2-dimethyl-1-(5-methylcyclohexa-1,3-dien-1-yl)propyl]-1-methylhydrazine.
| Compound Name | 1-[2,2-dimethyl-1-(5-methylcyclohexa-1,3-dien-1-yl)propyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 123200969 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-[2,2-dimethyl-1-(5-methylcyclohexa-1,3-dien-1-yl)propyl]-1-methylhydrazine |
| SMILES | CC1C=CC=C(C(N(C)N)C(C)(C)C)C1 |
| InChI | InChI=1S/C13H24N2/c1-10-7-6-8-11(9-10)12(15(5)14)13(2,3)4/h6-8,10,12H,9,14H2,1-5H3 |
| InChIKey | UGXWGVDQGBTOBL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|