C16H32N2 — CID 156743346
1-[1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)butan-2-yl]-1,2-dimethylhydrazine;ethane (PubChem CID 156743346) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 1-[1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)butan-2-yl]-1,2-dimethylhydrazine;ethane.
| Compound Name | 1-[1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)butan-2-yl]-1,2-dimethylhydrazine;ethane |
|---|---|
| PubChem CID | 156743346 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 1-[1-(1,4-dimethylcyclohexa-2,4-dien-1-yl)butan-2-yl]-1,2-dimethylhydrazine;ethane |
| SMILES | CC.CCC(CC1(C)C=CC(C)=CC1)N(C)NC |
| InChI | InChI=1S/C14H26N2.C2H6/c1-6-13(16(5)15-4)11-14(3)9-7-12(2)8-10-14;1-2/h7-9,13,15H,6,10-11H2,1-5H3;1-2H3 |
| InChIKey | PAUBAEWVRAVTOW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|