C39H32BNO3 — CID 150308401
5-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]-8-oxa-12-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene (PubChem CID 150308401) has the molecular formula C39H32BNO3 and a molecular weight of 573.50 g/mol. Its IUPAC name is 5-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]-8-oxa-12-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene.
| Compound Name | 5-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]-8-oxa-12-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene |
|---|---|
| PubChem CID | 150308401 |
| Molecular Formula | C39H32BNO3 |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 5-[4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]phenyl]-8-oxa-12-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaene |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4ccc(-c5ccc6c(c5)Oc5ccnc7cccc-6c57)cc4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C39H32BNO3/c1-38(2)39(3,4)44-40(43-38)31-19-16-28(17-20-31)27-10-8-25(9-11-27)26-12-14-29(15-13-26)30-18-21-32-33-6-5-7-34-37(33)35(22-23-41-34)42-36(32)24-30/h5-24H,1-4H3 |
| InChIKey | GLCCMXHZUHNCGT-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|