C21H22N2O2 — CID 150310284
methyl 4-anilino-1-(2-phenylethyl)pyridine-4-carboxylate (PubChem CID 150310284) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl 4-anilino-1-(2-phenylethyl)pyridine-4-carboxylate.
| Compound Name | methyl 4-anilino-1-(2-phenylethyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 150310284 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | methyl 4-anilino-1-(2-phenylethyl)pyridine-4-carboxylate |
| SMILES | COC(=O)C1(Nc2ccccc2)C=CN(CCc2ccccc2)C=C1 |
| InChI | InChI=1S/C21H22N2O2/c1-25-20(24)21(22-19-10-6-3-7-11-19)13-16-23(17-14-21)15-12-18-8-4-2-5-9-18/h2-11,13-14,16-17,22H,12,15H2,1H3 |
| InChIKey | GLLUELIWYGTHSW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |