C24H33NO5 — CID 150311284
2-ethoxy-4-[(2E)-3-methyl-2-[(2,3,4,5-tetramethoxyphenyl)methylidene]butyl]aniline (PubChem CID 150311284) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is 2-ethoxy-4-[(2E)-3-methyl-2-[(2,3,4,5-tetramethoxyphenyl)methylidene]butyl]aniline.
| Compound Name | 2-ethoxy-4-[(2E)-3-methyl-2-[(2,3,4,5-tetramethoxyphenyl)methylidene]butyl]aniline |
|---|---|
| PubChem CID | 150311284 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 2-ethoxy-4-[(2E)-3-methyl-2-[(2,3,4,5-tetramethoxyphenyl)methylidene]butyl]aniline |
| SMILES | CCOc1cc(C/C(=C\c2cc(OC)c(OC)c(OC)c2OC)C(C)C)ccc1N |
| InChI | InChI=1S/C24H33NO5/c1-8-30-20-12-16(9-10-19(20)25)11-17(15(2)3)13-18-14-21(26-4)23(28-6)24(29-7)22(18)27-5/h9-10,12-15H,8,11,25H2,1-7H3/b17-13+ |
| InChIKey | GLRINJGCVZWVTC-GHRIWEEISA-N |
| XLogP | 4.98 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|