C31H38FN5O2 — CID 150328036
4-[[(2-fluorobenzoyl)amino]-[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]-N,N-di(propan-2-yl)benzamide (PubChem CID 150328036) has the molecular formula C31H38FN5O2 and a molecular weight of 531.68 g/mol. Its IUPAC name is 4-[[(2-fluorobenzoyl)amino]-[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]-N,N-di(propan-2-yl)benzamide.
| Compound Name | 4-[[(2-fluorobenzoyl)amino]-[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 150328036 |
| Molecular Formula | C31H38FN5O2 |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | 4-[[(2-fluorobenzoyl)amino]-[1-(pyridin-2-ylmethyl)piperidin-4-yl]amino]-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1ccc(N(NC(=O)c2ccccc2F)C2CCN(Cc3ccccn3)CC2)cc1)C(C)C |
| InChI | InChI=1S/C31H38FN5O2/c1-22(2)36(23(3)4)31(39)24-12-14-26(15-13-24)37(34-30(38)28-10-5-6-11-29(28)32)27-16-19-35(20-17-27)21-25-9-7-8-18-33-25/h5-15,18,22-23,27H,16-17,19-21H2,1-4H3,(H,34,38) |
| InChIKey | GPBASRVZQDUMAP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|