C19H21N3O2 — CID 150350313
2,3-dimethyl-8-(3-phenylpropylamino)imidazo[1,2-a]pyridine-6-carboxylic acid (PubChem CID 150350313) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2,3-dimethyl-8-(3-phenylpropylamino)imidazo[1,2-a]pyridine-6-carboxylic acid.
| Compound Name | 2,3-dimethyl-8-(3-phenylpropylamino)imidazo[1,2-a]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 150350313 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2,3-dimethyl-8-(3-phenylpropylamino)imidazo[1,2-a]pyridine-6-carboxylic acid |
| SMILES | Cc1nc2c(NCCCc3ccccc3)cc(C(=O)O)cn2c1C |
| InChI | InChI=1S/C19H21N3O2/c1-13-14(2)22-12-16(19(23)24)11-17(18(22)21-13)20-10-6-9-15-7-4-3-5-8-15/h3-5,7-8,11-12,20H,6,9-10H2,1-2H3,(H,23,24) |
| InChIKey | GTPHNQNHASTJHX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|