About methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate
methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate (PubChem CID 15035410) has the molecular formula C12H22O3S
and a molecular weight of 246.37 g/mol. Its IUPAC name is methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate.
Molecular Properties
| Compound Name | methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate |
| PubChem CID | 15035410 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate |
| SMILES | CCCCSCC(=O)CC(C)(C)C(=O)OC |
| InChI | InChI=1S/C12H22O3S/c1-5-6-7-16-9-10(13)8-12(2,3)11(14)15-4/h5-9H2,1-4H3 |
| InChIKey | IKMFGMGRLUAJQC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate?
The IUPAC name of methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate (CID 15035410) is methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate.
What is the SMILES notation for methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate?
The canonical SMILES for methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate is CCCCSCC(=O)CC(C)(C)C(=O)OC.
What is the InChIKey of methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate?
The InChIKey is IKMFGMGRLUAJQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3S/c1-5-6-7-16-9-10(13)8-12(2,3)11(14)15-4/h5-9H2,1-4H3.
What are the key properties of methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate?
methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate has a molecular weight of 246.37 g/mol, XLogP of 2.68, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-butylsulfanyl-2,2-dimethyl-4-oxopentanoate is sourced from PubChem (CID 15035410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).