C23H27Cl2N5O2Si — CID 150365902
2-chloro-5-[8-chloro-2-(methylamino)quinolin-7-yl]-3-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 150365902) has the molecular formula C23H27Cl2N5O2Si and a molecular weight of 504.49 g/mol. Its IUPAC name is 2-chloro-5-[8-chloro-2-(methylamino)quinolin-7-yl]-3-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-chloro-5-[8-chloro-2-(methylamino)quinolin-7-yl]-3-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 150365902 |
| Molecular Formula | C23H27Cl2N5O2Si |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 2-chloro-5-[8-chloro-2-(methylamino)quinolin-7-yl]-3-methyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | CNc1ccc2ccc(-c3cn(COCC[Si](C)(C)C)c4nc(Cl)n(C)c(=O)c34)c(Cl)c2n1 |
| InChI | InChI=1S/C23H27Cl2N5O2Si/c1-26-17-9-7-14-6-8-15(19(24)20(14)27-17)16-12-30(13-32-10-11-33(3,4)5)21-18(16)22(31)29(2)23(25)28-21/h6-9,12H,10-11,13H2,1-5H3,(H,26,27) |
| InChIKey | GWRZLFCGEYUELK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|