C25H18F4N4O6S — CID 150389172
1-[5-cyano-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]-6-(trifluoromethylsulfonyloxy)-2-pyridinyl]cyclopropane-1-carboxylic acid (PubChem CID 150389172) has the molecular formula C25H18F4N4O6S and a molecular weight of 578.50 g/mol. Its IUPAC name is 1-[5-cyano-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]-6-(trifluoromethylsulfonyloxy)-2-pyridinyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[5-cyano-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]-6-(trifluoromethylsulfonyloxy)-2-pyridinyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 150389172 |
| Molecular Formula | C25H18F4N4O6S |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | 1-[5-cyano-4-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenyl]-6-(trifluoromethylsulfonyloxy)-2-pyridinyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-c3cc(C4(C(=O)O)CC4)nc(OS(=O)(=O)C(F)(F)F)c3C#N)cc2)c1 |
| InChI | InChI=1S/C25H18F4N4O6S/c1-13-2-7-18(26)19(10-13)32-23(36)31-15-5-3-14(4-6-15)16-11-20(24(8-9-24)22(34)35)33-21(17(16)12-30)39-40(37,38)25(27,28)29/h2-7,10-11H,8-9H2,1H3,(H,34,35)(H2,31,32,36) |
| InChIKey | HBIIQSHQYFQCHT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 158.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|