C24H20F4N4O4S — CID 58751682
[6-tert-butyl-3-cyano-4-[4-[(2-fluorophenyl)carbamoylamino]phenyl]-2-pyridinyl] trifluoromethanesulfonate (PubChem CID 58751682) has the molecular formula C24H20F4N4O4S and a molecular weight of 536.51 g/mol. Its IUPAC name is [6-tert-butyl-3-cyano-4-[4-[(2-fluorophenyl)carbamoylamino]phenyl]-2-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [6-tert-butyl-3-cyano-4-[4-[(2-fluorophenyl)carbamoylamino]phenyl]-2-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58751682 |
| Molecular Formula | C24H20F4N4O4S |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | [6-tert-butyl-3-cyano-4-[4-[(2-fluorophenyl)carbamoylamino]phenyl]-2-pyridinyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1cc(-c2ccc(NC(=O)Nc3ccccc3F)cc2)c(C#N)c(OS(=O)(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C24H20F4N4O4S/c1-23(2,3)20-12-16(17(13-29)21(32-20)36-37(34,35)24(26,27)28)14-8-10-15(11-9-14)30-22(33)31-19-7-5-4-6-18(19)25/h4-12H,1-3H3,(H2,30,31,33) |
| InChIKey | VOVSJAJHJSXTOJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|