About (3,4,9-triethylcarbazol-2-yl) benzoate
(3,4,9-triethylcarbazol-2-yl) benzoate (PubChem CID 150434883) has the molecular formula C25H25NO2
and a molecular weight of 371.48 g/mol. Its IUPAC name is (3,4,9-triethylcarbazol-2-yl) benzoate.
Molecular Properties
| Compound Name | (3,4,9-triethylcarbazol-2-yl) benzoate |
| PubChem CID | 150434883 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (3,4,9-triethylcarbazol-2-yl) benzoate |
| SMILES | CCc1c(OC(=O)c2ccccc2)cc2c(c1CC)c1ccccc1n2CC |
| InChI | InChI=1S/C25H25NO2/c1-4-18-19(5-2)24-20-14-10-11-15-21(20)26(6-3)22(24)16-23(18)28-25(27)17-12-8-7-9-13-17/h7-16H,4-6H2,1-3H3 |
| InChIKey | HKNXSVZUKWCUNC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3,4,9-triethylcarbazol-2-yl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,9-triethylcarbazol-2-yl) benzoate?
The IUPAC name of (3,4,9-triethylcarbazol-2-yl) benzoate (CID 150434883) is (3,4,9-triethylcarbazol-2-yl) benzoate.
What is the SMILES notation for (3,4,9-triethylcarbazol-2-yl) benzoate?
The canonical SMILES for (3,4,9-triethylcarbazol-2-yl) benzoate is CCc1c(OC(=O)c2ccccc2)cc2c(c1CC)c1ccccc1n2CC.
What is the InChIKey of (3,4,9-triethylcarbazol-2-yl) benzoate?
The InChIKey is HKNXSVZUKWCUNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO2/c1-4-18-19(5-2)24-20-14-10-11-15-21(20)26(6-3)22(24)16-23(18)28-25(27)17-12-8-7-9-13-17/h7-16H,4-6H2,1-3H3.
What are the key properties of (3,4,9-triethylcarbazol-2-yl) benzoate?
(3,4,9-triethylcarbazol-2-yl) benzoate has a molecular weight of 371.48 g/mol, XLogP of 6.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,9-triethylcarbazol-2-yl) benzoate is sourced from PubChem (CID 150434883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).