About 2-sulfanylprop-2-enoyl isocyanate
2-sulfanylprop-2-enoyl isocyanate (PubChem CID 150440849) has the molecular formula C4H3NO2S
and a molecular weight of 129.14 g/mol. Its IUPAC name is 2-sulfanylprop-2-enoyl isocyanate.
Molecular Properties
| Compound Name | 2-sulfanylprop-2-enoyl isocyanate |
| PubChem CID | 150440849 |
| Molecular Formula | C4H3NO2S |
| Molecular Weight | 129.14 g/mol |
| Exact Mass | 128.99 |
| IUPAC Name | 2-sulfanylprop-2-enoyl isocyanate |
| SMILES | C=C(S)C(=O)N=C=O |
| InChI | InChI=1S/C4H3NO2S/c1-3(8)4(7)5-2-6/h8H,1H2 |
| InChIKey | HLSUXNGBGSCYDU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.14 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylprop-2-enoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylprop-2-enoyl isocyanate?
The IUPAC name of 2-sulfanylprop-2-enoyl isocyanate (CID 150440849) is 2-sulfanylprop-2-enoyl isocyanate.
What is the SMILES notation for 2-sulfanylprop-2-enoyl isocyanate?
The canonical SMILES for 2-sulfanylprop-2-enoyl isocyanate is C=C(S)C(=O)N=C=O.
What is the InChIKey of 2-sulfanylprop-2-enoyl isocyanate?
The InChIKey is HLSUXNGBGSCYDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2S/c1-3(8)4(7)5-2-6/h8H,1H2.
What are the key properties of 2-sulfanylprop-2-enoyl isocyanate?
2-sulfanylprop-2-enoyl isocyanate has a molecular weight of 129.14 g/mol, XLogP of 0.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylprop-2-enoyl isocyanate is sourced from PubChem (CID 150440849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).