C10H8Cl6N2O2 — CID 87877113
1,1-diisocyanatoethene;1,2,3,4,5,6-hexachlorocyclohexane (PubChem CID 87877113) has the molecular formula C10H8Cl6N2O2 and a molecular weight of 400.90 g/mol. Its IUPAC name is 1,1-diisocyanatoethene;1,2,3,4,5,6-hexachlorocyclohexane.
| Compound Name | 1,1-diisocyanatoethene;1,2,3,4,5,6-hexachlorocyclohexane |
|---|---|
| PubChem CID | 87877113 |
| Molecular Formula | C10H8Cl6N2O2 |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 397.87 |
| IUPAC Name | 1,1-diisocyanatoethene;1,2,3,4,5,6-hexachlorocyclohexane |
| SMILES | C=C(N=C=O)N=C=O.ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl |
| InChI | InChI=1S/C6H6Cl6.C4H2N2O2/c7-1-2(8)4(10)6(12)5(11)3(1)9;1-4(5-2-7)6-3-8/h1-6H;1H2 |
| InChIKey | XSFDSDZXDZDERX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.90 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|