About 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid
2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid (PubChem CID 15045150) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid |
| PubChem CID | 15045150 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid |
| SMILES | NCC[C@@H]1C[C@H](CC(=O)O)OCO1 |
| InChI | InChI=1S/C8H15NO4/c9-2-1-6-3-7(4-8(10)11)13-5-12-6/h6-7H,1-5,9H2,(H,10,11)/t6-,7-/m1/s1 |
| InChIKey | AQCCDCWWIAQFSK-RNFRBKRXSA-N |
| XLogP | -0.06 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid?
The IUPAC name of 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid (CID 15045150) is 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid.
What is the SMILES notation for 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid?
The canonical SMILES for 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid is NCC[C@@H]1C[C@H](CC(=O)O)OCO1.
What is the InChIKey of 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid?
The InChIKey is AQCCDCWWIAQFSK-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H15NO4/c9-2-1-6-3-7(4-8(10)11)13-5-12-6/h6-7H,1-5,9H2,(H,10,11)/t6-,7-/m1/s1.
What are the key properties of 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid?
2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid has a molecular weight of 189.21 g/mol, XLogP of -0.06, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R,6R)-6-(2-aminoethyl)-1,3-dioxan-4-yl]acetic acid is sourced from PubChem (CID 15045150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).