C22H22O3P+ — CID 150453949
[2,3-bis(4-hydroxyphenyl)phenyl]-tert-butyl-oxophosphanium (PubChem CID 150453949) has the molecular formula C22H22O3P+ and a molecular weight of 365.39 g/mol. Its IUPAC name is [2,3-bis(4-hydroxyphenyl)phenyl]-tert-butyl-oxophosphanium.
| Compound Name | [2,3-bis(4-hydroxyphenyl)phenyl]-tert-butyl-oxophosphanium |
|---|---|
| PubChem CID | 150453949 |
| Molecular Formula | C22H22O3P+ |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | [2,3-bis(4-hydroxyphenyl)phenyl]-tert-butyl-oxophosphanium |
| SMILES | CC(C)(C)[P+](=O)c1cccc(-c2ccc(O)cc2)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C22H21O3P/c1-22(2,3)26(25)20-6-4-5-19(15-7-11-17(23)12-8-15)21(20)16-9-13-18(24)14-10-16/h4-14H,1-3H3,(H-,23,24,25)/p+1 |
| InChIKey | ZXUATXHFGDWNRP-UHFFFAOYSA-O |
| XLogP | 5.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|