C11H13NO — CID 15047390
3-ethoxy-1,4-dihydroisoquinoline (PubChem CID 15047390) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-ethoxy-1,4-dihydroisoquinoline.
| Compound Name | 3-ethoxy-1,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 15047390 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-ethoxy-1,4-dihydroisoquinoline |
| SMILES | CCOC1=NCc2ccccc2C1 |
| InChI | InChI=1S/C11H13NO/c1-2-13-11-7-9-5-3-4-6-10(9)8-12-11/h3-6H,2,7-8H2,1H3 |
| InChIKey | BJBZDVJEJGGSIV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |