C13H12F12O — CID 15048144
(E)-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluoro-2-pentyloct-2-enal (PubChem CID 15048144) has the molecular formula C13H12F12O and a molecular weight of 412.21 g/mol. Its IUPAC name is (E)-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluoro-2-pentyloct-2-enal.
| Compound Name | (E)-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluoro-2-pentyloct-2-enal |
|---|---|
| PubChem CID | 15048144 |
| Molecular Formula | C13H12F12O |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (E)-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluoro-2-pentyloct-2-enal |
| SMILES | CCCCC/C(C=O)=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H12F12O/c1-2-3-4-5-7(6-26)8(14)9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)25/h6H,2-5H2,1H3/b8-7+ |
| InChIKey | SIPHTAACLPGCEZ-BQYQJAHWSA-N |
| XLogP | 6.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|