C21H15NO2S — CID 15048526
(2S,10R)-9λ6-thia-7-azahexacyclo[9.6.6.02,10.03,8.012,17.018,23]tricosa-3(8),4,6,12,14,16,18,20,22-nonaene 9,9-dioxide (PubChem CID 15048526) has the molecular formula C21H15NO2S and a molecular weight of 345.42 g/mol. Its IUPAC name is (2S,10R)-9λ6-thia-7-azahexacyclo[9.6.6.02,10.03,8.012,17.018,23]tricosa-3(8),4,6,12,14,16,18,20,22-nonaene 9,9-dioxide.
| Compound Name | (2S,10R)-9λ6-thia-7-azahexacyclo[9.6.6.02,10.03,8.012,17.018,23]tricosa-3(8),4,6,12,14,16,18,20,22-nonaene 9,9-dioxide |
|---|---|
| PubChem CID | 15048526 |
| Molecular Formula | C21H15NO2S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (2S,10R)-9λ6-thia-7-azahexacyclo[9.6.6.02,10.03,8.012,17.018,23]tricosa-3(8),4,6,12,14,16,18,20,22-nonaene 9,9-dioxide |
| SMILES | O=S1(=O)c2ncccc2[C@@H]2C3c4ccccc4C(c4ccccc43)[C@@H]21 |
| InChI | InChI=1S/C21H15NO2S/c23-25(24)20-18-14-8-3-1-6-12(14)17(13-7-2-4-9-15(13)18)19(20)16-10-5-11-22-21(16)25/h1-11,17-20H/t17?,18?,19-,20+/m1/s1 |
| InChIKey | XDZYQMZMSCDXJE-TUNPWDSISA-N |
| XLogP | 3.61 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |