About benzamido 3-oxobutanoate
benzamido 3-oxobutanoate (PubChem CID 15049275) has the molecular formula C11H11NO4
and a molecular weight of 221.21 g/mol. Its IUPAC name is benzamido 3-oxobutanoate.
Molecular Properties
| Compound Name | benzamido 3-oxobutanoate |
| PubChem CID | 15049275 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | benzamido 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)ONC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H11NO4/c1-8(13)7-10(14)16-12-11(15)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,12,15) |
| InChIKey | FJXPNAXJEAXULQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzamido 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamido 3-oxobutanoate?
The IUPAC name of benzamido 3-oxobutanoate (CID 15049275) is benzamido 3-oxobutanoate.
What is the SMILES notation for benzamido 3-oxobutanoate?
The canonical SMILES for benzamido 3-oxobutanoate is CC(=O)CC(=O)ONC(=O)c1ccccc1.
What is the InChIKey of benzamido 3-oxobutanoate?
The InChIKey is FJXPNAXJEAXULQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c1-8(13)7-10(14)16-12-11(15)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,12,15).
What are the key properties of benzamido 3-oxobutanoate?
benzamido 3-oxobutanoate has a molecular weight of 221.21 g/mol, XLogP of 0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzamido 3-oxobutanoate is sourced from PubChem (CID 15049275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).