C17H19N5OS — CID 15049927
2-benzyl-5-(dimethylamino)-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-8-one (PubChem CID 15049927) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is 2-benzyl-5-(dimethylamino)-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-8-one.
| Compound Name | 2-benzyl-5-(dimethylamino)-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 15049927 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-benzyl-5-(dimethylamino)-10-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-8-one |
| SMILES | CN(C)c1nc2n(Cc3ccccc3)c3c(c(=O)n2n1)SCCC3 |
| InChI | InChI=1S/C17H19N5OS/c1-20(2)16-18-17-21(11-12-7-4-3-5-8-12)13-9-6-10-24-14(13)15(23)22(17)19-16/h3-5,7-8H,6,9-11H2,1-2H3 |
| InChIKey | BGUCFLKNJCFMOO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |