C27H28N2O3 — CID 15058023
3-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]propyl acetate (PubChem CID 15058023) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 3-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]propyl acetate.
| Compound Name | 3-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]propyl acetate |
|---|---|
| PubChem CID | 15058023 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 3-[(2S,3S)-4-oxo-3-(tritylamino)azetidin-2-yl]propyl acetate |
| SMILES | CC(=O)OCCC[C@@H]1NC(=O)[C@H]1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O3/c1-20(30)32-19-11-18-24-25(26(31)28-24)29-27(21-12-5-2-6-13-21,22-14-7-3-8-15-22)23-16-9-4-10-17-23/h2-10,12-17,24-25,29H,11,18-19H2,1H3,(H,28,31)/t24-,25-/m0/s1 |
| InChIKey | DIPBLEKWHSVUDO-DQEYMECFSA-N |
| XLogP | 3.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|