C18H33N7O3 — CID 15060297
(2S)-1-(2-aminoacetyl)-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-piperidin-1-ylpentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 15060297) has the molecular formula C18H33N7O3 and a molecular weight of 395.51 g/mol. Its IUPAC name is (2S)-1-(2-aminoacetyl)-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-piperidin-1-ylpentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2-aminoacetyl)-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-piperidin-1-ylpentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 15060297 |
| Molecular Formula | C18H33N7O3 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (2S)-1-(2-aminoacetyl)-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-piperidin-1-ylpentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H33N7O3/c19-12-15(26)25-11-5-7-14(25)16(27)23-13(6-4-8-22-18(20)21)17(28)24-9-2-1-3-10-24/h13-14H,1-12,19H2,(H,23,27)(H4,20,21,22)/t13-,14-/m0/s1 |
| InChIKey | HXDBWPPAOMLCGI-KBPBESRZSA-N |
| XLogP | -1.51 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|