C17H22N2 — CID 150607535
N'-butan-2-yl-N,N'-diphenylmethanediamine (PubChem CID 150607535) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N'-butan-2-yl-N,N'-diphenylmethanediamine.
| Compound Name | N'-butan-2-yl-N,N'-diphenylmethanediamine |
|---|---|
| PubChem CID | 150607535 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N'-butan-2-yl-N,N'-diphenylmethanediamine |
| SMILES | CCC(C)N(CNc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H22N2/c1-3-15(2)19(17-12-8-5-9-13-17)14-18-16-10-6-4-7-11-16/h4-13,15,18H,3,14H2,1-2H3 |
| InChIKey | ITEREKCRPJBHLV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|