C15H18N2S — CID 134969852
N'-(methylsulfanylmethyl)-N,N'-diphenylmethanediamine (PubChem CID 134969852) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is N'-(methylsulfanylmethyl)-N,N'-diphenylmethanediamine.
| Compound Name | N'-(methylsulfanylmethyl)-N,N'-diphenylmethanediamine |
|---|---|
| PubChem CID | 134969852 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N'-(methylsulfanylmethyl)-N,N'-diphenylmethanediamine |
| SMILES | CSCN(CNc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H18N2S/c1-18-13-17(15-10-6-3-7-11-15)12-16-14-8-4-2-5-9-14/h2-11,16H,12-13H2,1H3 |
| InChIKey | OJQHLMGUOVEWIJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|